C11H13Cl2NOS — CID 42910761
2,2-dichloro-1-methyl-N-(2-thiophen-2-ylethyl)cyclopropane-1-carboxamide (PubChem CID 42910761) has the molecular formula C11H13Cl2NOS and a molecular weight of 278.20 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-(2-thiophen-2-ylethyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-(2-thiophen-2-ylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42910761 |
| Molecular Formula | C11H13Cl2NOS |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-(2-thiophen-2-ylethyl)cyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCCc2cccs2)CC1(Cl)Cl |
| InChI | InChI=1S/C11H13Cl2NOS/c1-10(7-11(10,12)13)9(15)14-5-4-8-3-2-6-16-8/h2-3,6H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | WLQXHMHJAXUFEE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|