C18H25BrN4O — CID 99803798
(5R,7R)-3-bromo-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]adamantane-1-carboxamide (PubChem CID 99803798) has the molecular formula C18H25BrN4O and a molecular weight of 393.33 g/mol. Its IUPAC name is (5R,7R)-3-bromo-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-bromo-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 99803798 |
| Molecular Formula | C18H25BrN4O |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (5R,7R)-3-bromo-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(NCCNC(=O)C23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)nn1 |
| InChI | InChI=1S/C18H25BrN4O/c1-12-2-3-15(23-22-12)20-4-5-21-16(24)17-7-13-6-14(8-17)10-18(19,9-13)11-17/h2-3,13-14H,4-11H2,1H3,(H,20,23)(H,21,24)/t13-,14-,17?,18?/m1/s1 |
| InChIKey | JSTVRWBSKAQRBP-JDPPGYRCSA-N |
| XLogP | 3.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|