C16H19BrN2O3 — CID 4842706
N'-(3-bromoadamantane-1-carbonyl)furan-2-carbohydrazide (PubChem CID 4842706) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is N'-(3-bromoadamantane-1-carbonyl)furan-2-carbohydrazide.
| Compound Name | N'-(3-bromoadamantane-1-carbonyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 4842706 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N'-(3-bromoadamantane-1-carbonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C12CC3CC(CC(Br)(C3)C1)C2)c1ccco1 |
| InChI | InChI=1S/C16H19BrN2O3/c17-16-7-10-4-11(8-16)6-15(5-10,9-16)14(21)19-18-13(20)12-2-1-3-22-12/h1-3,10-11H,4-9H2,(H,18,20)(H,19,21) |
| InChIKey | IBQFCQUCDSRRMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|