C22H29BrN2O4 — CID 134014769
3-bromo-N'-(3-methoxy-4-propan-2-yloxybenzoyl)adamantane-1-carbohydrazide (PubChem CID 134014769) has the molecular formula C22H29BrN2O4 and a molecular weight of 465.39 g/mol. Its IUPAC name is 3-bromo-N'-(3-methoxy-4-propan-2-yloxybenzoyl)adamantane-1-carbohydrazide.
| Compound Name | 3-bromo-N'-(3-methoxy-4-propan-2-yloxybenzoyl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 134014769 |
| Molecular Formula | C22H29BrN2O4 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 3-bromo-N'-(3-methoxy-4-propan-2-yloxybenzoyl)adamantane-1-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)C23CC4CC(CC(Br)(C4)C2)C3)ccc1OC(C)C |
| InChI | InChI=1S/C22H29BrN2O4/c1-13(2)29-17-5-4-16(7-18(17)28-3)19(26)24-25-20(27)21-8-14-6-15(9-21)11-22(23,10-14)12-21/h4-5,7,13-15H,6,8-12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | XXJSKPCXOJDEFD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|