C26H29BrN2O2 — CID 5294904
3-bromo-N-[2-[(4-ethylphenyl)carbamoyl]phenyl]adamantane-1-carboxamide (PubChem CID 5294904) has the molecular formula C26H29BrN2O2 and a molecular weight of 481.43 g/mol. Its IUPAC name is 3-bromo-N-[2-[(4-ethylphenyl)carbamoyl]phenyl]adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-[2-[(4-ethylphenyl)carbamoyl]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 5294904 |
| Molecular Formula | C26H29BrN2O2 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-bromo-N-[2-[(4-ethylphenyl)carbamoyl]phenyl]adamantane-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccccc2NC(=O)C23CC4CC(CC(Br)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H29BrN2O2/c1-2-17-7-9-20(10-8-17)28-23(30)21-5-3-4-6-22(21)29-24(31)25-12-18-11-19(13-25)15-26(27,14-18)16-25/h3-10,18-19H,2,11-16H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | ACHWSZYRHIUQLS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|