C21H26BrN3O — CID 24549089
3-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]adamantane-1-carboxamide (PubChem CID 24549089) has the molecular formula C21H26BrN3O and a molecular weight of 416.36 g/mol. Its IUPAC name is 3-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 24549089 |
| Molecular Formula | C21H26BrN3O |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]adamantane-1-carboxamide |
| SMILES | CCn1c(CNC(=O)C23CC4CC(CC(Br)(C4)C2)C3)nc2ccccc21 |
| InChI | InChI=1S/C21H26BrN3O/c1-2-25-17-6-4-3-5-16(17)24-18(25)12-23-19(26)20-8-14-7-15(9-20)11-21(22,10-14)13-20/h3-6,14-15H,2,7-13H2,1H3,(H,23,26) |
| InChIKey | TYDXYPKDTFHEPI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|