C24H32N2O5 — CID 8528675
[2-(2-methoxy-5-methylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8528675) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8528675 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | COc1ccc(C)cc1NC(=O)COC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O5/c1-15-3-4-20(30-2)19(7-15)26-21(27)14-31-22(28)5-6-25-23(29)24-11-16-8-17(12-24)10-18(9-16)13-24/h3-4,7,16-18H,5-6,8-14H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | MZUCICQDGRYIAX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |