C12H16ClN5O — CID 872072
(5S,7R)-3-chloro-N-(2H-tetrazol-5-yl)adamantane-1-carboxamide (PubChem CID 872072) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(2H-tetrazol-5-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(2H-tetrazol-5-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 872072 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (5S,7R)-3-chloro-N-(2H-tetrazol-5-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nn[nH]n1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C12H16ClN5O/c13-12-4-7-1-8(5-12)3-11(2-7,6-12)9(19)14-10-15-17-18-16-10/h7-8H,1-6H2,(H2,14,15,16,17,18,19)/t7-,8+,11?,12? |
| InChIKey | NFTDHZHHFJZXBA-FIESBSMHSA-N |
| XLogP | 1.72 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|