C29H28N4O4 — CID 126686377
(8aS)-2-[2-(4-methoxyphenyl)cyclopropyl]-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide (PubChem CID 126686377) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is (8aS)-2-[2-(4-methoxyphenyl)cyclopropyl]-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide.
| Compound Name | (8aS)-2-[2-(4-methoxyphenyl)cyclopropyl]-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 126686377 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (8aS)-2-[2-(4-methoxyphenyl)cyclopropyl]-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
| SMILES | COc1ccc(C2CC2N2C(=O)[C@@H]3CN(C(=O)Nc4ccccc4-c4ccccc4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C29H28N4O4/c1-37-21-13-11-20(12-14-21)23-17-25(23)33-27(34)26-18-31(15-16-32(26)29(33)36)28(35)30-24-10-6-5-9-22(24)19-7-3-2-4-8-19/h2-14,23,25-26H,15-18H2,1H3,(H,30,35)/t23?,25?,26-/m0/s1 |
| InChIKey | YXNDCKDHVXICPD-HEIUKZKOSA-N |
| XLogP | 4.40 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|