C20H22F3N3O — CID 17381843
3-methyl-4-(4-methylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 17381843) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 3-methyl-4-(4-methylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17381843 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-methyl-4-(4-methylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)Nc3ccccc3C(F)(F)F)CC2C)cc1 |
| InChI | InChI=1S/C20H22F3N3O/c1-14-7-9-16(10-8-14)26-12-11-25(13-15(26)2)19(27)24-18-6-4-3-5-17(18)20(21,22)23/h3-10,15H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | IMGBZANQLKPDAY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|