C20H24ClN3O — CID 3330309
N-(5-chloro-2-methylphenyl)-3-methyl-4-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 3330309) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-methyl-4-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-methyl-4-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3330309 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-methyl-4-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)Nc3cc(Cl)ccc3C)CC2C)c1 |
| InChI | InChI=1S/C20H24ClN3O/c1-14-5-4-6-18(11-14)24-10-9-23(13-16(24)3)20(25)22-19-12-17(21)8-7-15(19)2/h4-8,11-12,16H,9-10,13H2,1-3H3,(H,22,25) |
| InChIKey | HBKZZASALJILKO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |