C19H33N3OS — CID 98786354
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2-ethylbutanoyl)piperidin-4-yl]thiourea (PubChem CID 98786354) has the molecular formula C19H33N3OS and a molecular weight of 351.56 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2-ethylbutanoyl)piperidin-4-yl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2-ethylbutanoyl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 98786354 |
| Molecular Formula | C19H33N3OS |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2-ethylbutanoyl)piperidin-4-yl]thiourea |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=S)N[C@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H33N3OS/c1-3-14(4-2)18(23)22-9-7-16(8-10-22)20-19(24)21-17-12-13-5-6-15(17)11-13/h13-17H,3-12H2,1-2H3,(H2,20,21,24)/t13-,15-,17-/m0/s1 |
| InChIKey | ZDEIHGXNDZBKRE-QRTARXTBSA-N |
| XLogP | 3.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|