C21H38IN5O2 — CID 110039186
2-[[(2-bicyclo[2.2.1]heptanylamino)-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110039186) has the molecular formula C21H38IN5O2 and a molecular weight of 519.47 g/mol. Its IUPAC name is 2-[[(2-bicyclo[2.2.1]heptanylamino)-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-bicyclo[2.2.1]heptanylamino)-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110039186 |
| Molecular Formula | C21H38IN5O2 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[[(2-bicyclo[2.2.1]heptanylamino)-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(C)C(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NC2CC3CCC2C3)CC1.I |
| InChI | InChI=1S/C21H37N5O2.HI/c1-14(2)20(28)26-9-7-17(8-10-26)23-21(22-13-19(27)25(3)4)24-18-12-15-5-6-16(18)11-15;/h14-18H,5-13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | BPTOXAXQUMGJBI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|