C20H30N4O3S — CID 86890686
4-(2-cyanophenyl)sulfonyl-N-(5,5-dimethylhexyl)piperazine-1-carboxamide (PubChem CID 86890686) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 4-(2-cyanophenyl)sulfonyl-N-(5,5-dimethylhexyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-cyanophenyl)sulfonyl-N-(5,5-dimethylhexyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86890686 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-(2-cyanophenyl)sulfonyl-N-(5,5-dimethylhexyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)CCCCNC(=O)N1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C20H30N4O3S/c1-20(2,3)10-6-7-11-22-19(25)23-12-14-24(15-13-23)28(26,27)18-9-5-4-8-17(18)16-21/h4-5,8-9H,6-7,10-15H2,1-3H3,(H,22,25) |
| InChIKey | WECVCLHESXUQFT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|