C14H17N3O2S — CID 115478402
1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]pyrazol-3-amine (PubChem CID 115478402) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]pyrazol-3-amine.
| Compound Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 115478402 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCCSc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C14H17N3O2S/c15-14-4-6-17(16-14)5-1-9-20-11-2-3-12-13(10-11)19-8-7-18-12/h2-4,6,10H,1,5,7-9H2,(H2,15,16) |
| InChIKey | KSFNWGHTZFMXMT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|