C28H22O6S2 — CID 155776373
5-[[3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]disulfanyl]phenoxy]methyl]-1,3-benzodioxole (PubChem CID 155776373) has the molecular formula C28H22O6S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is 5-[[3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]disulfanyl]phenoxy]methyl]-1,3-benzodioxole.
| Compound Name | 5-[[3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]disulfanyl]phenoxy]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 155776373 |
| Molecular Formula | C28H22O6S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 5-[[3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]disulfanyl]phenoxy]methyl]-1,3-benzodioxole |
| SMILES | c1cc(OCc2ccc3c(c2)OCO3)cc(SSc2cccc(OCc3ccc4c(c3)OCO4)c2)c1 |
| InChI | InChI=1S/C28H22O6S2/c1-3-21(29-15-19-7-9-25-27(11-19)33-17-31-25)13-23(5-1)35-36-24-6-2-4-22(14-24)30-16-20-8-10-26-28(12-20)34-18-32-26/h1-14H,15-18H2 |
| InChIKey | UOWSTVHJIZMMBL-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|