C19H19CsO4S — CID 155795521
cesium 5-[[3-[[(4R)-4-methyl-2,3,4,5-tetrahydrofuran-5-id-2-yl]sulfanyl]phenoxy]methyl]-1,3-benzodioxole (PubChem CID 155795521) has the molecular formula C19H19CsO4S and a molecular weight of 476.33 g/mol. Its IUPAC name is cesium 5-[[3-[[(4R)-4-methyl-2,3,4,5-tetrahydrofuran-5-id-2-yl]sulfanyl]phenoxy]methyl]-1,3-benzodioxole.
| Compound Name | cesium 5-[[3-[[(4R)-4-methyl-2,3,4,5-tetrahydrofuran-5-id-2-yl]sulfanyl]phenoxy]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 155795521 |
| Molecular Formula | C19H19CsO4S |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | cesium 5-[[3-[[(4R)-4-methyl-2,3,4,5-tetrahydrofuran-5-id-2-yl]sulfanyl]phenoxy]methyl]-1,3-benzodioxole |
| SMILES | C[C@H]1[CH-]OC(Sc2cccc(OCc3ccc4c(c3)OCO4)c2)C1.[Cs+] |
| InChI | InChI=1S/C19H19O4S.Cs/c1-13-7-19(21-10-13)24-16-4-2-3-15(9-16)20-11-14-5-6-17-18(8-14)23-12-22-17;/h2-6,8-10,13,19H,7,11-12H2,1H3;/q-1;+1/t13-,19?;/m1./s1 |
| InChIKey | MOAXKJXLNSNTHQ-LXGHZNGXSA-N |
| XLogP | 1.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|