2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate

C14H12N2O3 — CID 142851228

IUPAC2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate
SMILESO=C(OCc1ccc2c(c1)CCO2)c1ccncn1
InChIInChI=1S/C14H12N2O3/c17-14(12-3-5-15-9-16-12)19-8-10-1-2-13-11(7-10)4-6-18-13/h1-3,5,7,9H,4,6,8H2
InChIKeyWRHSBIWNPCBVLE-UHFFFAOYSA-N
MW256.26 g/mol
LogP1.77
Rot. Bonds3

About 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate

2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate (PubChem CID 142851228) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate.

Molecular Properties

Compound Name2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate
PubChem CID142851228
Molecular FormulaC14H12N2O3
Molecular Weight256.26 g/mol
Exact Mass256.08
IUPAC Name2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate
SMILESO=C(OCc1ccc2c(c1)CCO2)c1ccncn1
InChIInChI=1S/C14H12N2O3/c17-14(12-3-5-15-9-16-12)19-8-10-1-2-13-11(7-10)4-6-18-13/h1-3,5,7,9H,4,6,8H2
InChIKeyWRHSBIWNPCBVLE-UHFFFAOYSA-N
XLogP1.77
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.26
LogP ≤ 51.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate?
The IUPAC name of 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate (CID 142851228) is 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate.
What is the SMILES notation for 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate?
The canonical SMILES for 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate is O=C(OCc1ccc2c(c1)CCO2)c1ccncn1.
What is the InChIKey of 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate?
The InChIKey is WRHSBIWNPCBVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c17-14(12-3-5-15-9-16-12)19-8-10-1-2-13-11(7-10)4-6-18-13/h1-3,5,7,9H,4,6,8H2.
What are the key properties of 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate?
2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate has a molecular weight of 256.26 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzofuran-5-ylmethyl pyrimidine-4-carboxylate is sourced from PubChem (CID 142851228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).