C17H17NO3 — CID 65445543
2-(2,3-dihydro-1-benzofuran-5-yl)ethyl 4-aminobenzoate (PubChem CID 65445543) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)ethyl 4-aminobenzoate.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethyl 4-aminobenzoate |
|---|---|
| PubChem CID | 65445543 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethyl 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCCc2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C17H17NO3/c18-15-4-2-13(3-5-15)17(19)21-9-7-12-1-6-16-14(11-12)8-10-20-16/h1-6,11H,7-10,18H2 |
| InChIKey | VJQBUTDPSUVAEQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|