C28H47NO7 — CID 88834533
(Z)-N-decoxy-1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethanimine (PubChem CID 88834533) has the molecular formula C28H47NO7 and a molecular weight of 509.68 g/mol. Its IUPAC name is (Z)-N-decoxy-1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethanimine.
| Compound Name | (Z)-N-decoxy-1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethanimine |
|---|---|
| PubChem CID | 88834533 |
| Molecular Formula | C28H47NO7 |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | (Z)-N-decoxy-1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethanimine |
| SMILES | CCCCCCCCCCO/N=C(/C)c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C28H47NO7/c1-3-4-5-6-7-8-9-10-13-36-29-25(2)26-11-12-27-28(24-26)35-23-21-33-19-17-31-15-14-30-16-18-32-20-22-34-27/h11-12,24H,3-10,13-23H2,1-2H3/b29-25- |
| InChIKey | USKNIOSGZDDUPD-GNVQSUKOSA-N |
| XLogP | 5.41 |
| TPSA | 76.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|