C29H27ClN2O6 — CID 19450681
5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19450681) has the molecular formula C29H27ClN2O6 and a molecular weight of 535.00 g/mol. Its IUPAC name is 5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19450681 |
| Molecular Formula | C29H27ClN2O6 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)Nc3cc(Oc4ccc(Cl)cc4C)cc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C29H27ClN2O6/c1-4-18(2)20-5-8-24(9-6-20)36-17-25-10-12-28(37-25)29(33)31-22-14-23(32(34)35)16-26(15-22)38-27-11-7-21(30)13-19(27)3/h5-16,18H,4,17H2,1-3H3,(H,31,33) |
| InChIKey | UMQIEJJUYKVAJN-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|