C15H11ClN4O5 — CID 136863890
N-(4-chloro-3-nitrophenyl)-N'-[(Z)-(2-hydroxyphenyl)methylideneamino]oxamide (PubChem CID 136863890) has the molecular formula C15H11ClN4O5 and a molecular weight of 362.73 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-N'-[(Z)-(2-hydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-N'-[(Z)-(2-hydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 136863890 |
| Molecular Formula | C15H11ClN4O5 |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-N'-[(Z)-(2-hydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccccc1O)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11ClN4O5/c16-11-6-5-10(7-12(11)20(24)25)18-14(22)15(23)19-17-8-9-3-1-2-4-13(9)21/h1-8,21H,(H,18,22)(H,19,23)/b17-8- |
| InChIKey | BEUOUHHWTCTHOR-IUXPMGMMSA-N |
| XLogP | 2.04 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|