C26H20ClN3O4S — CID 3476951
[3-[[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 3476951) has the molecular formula C26H20ClN3O4S and a molecular weight of 505.98 g/mol. Its IUPAC name is [3-[[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [3-[[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3476951 |
| Molecular Formula | C26H20ClN3O4S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | [3-[[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccccc1C(=O)NCC(=O)NN=Cc1cccc(OC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C26H20ClN3O4S/c1-16-7-2-3-10-19(16)25(32)28-15-22(31)30-29-14-17-8-6-9-18(13-17)34-26(33)24-23(27)20-11-4-5-12-21(20)35-24/h2-14H,15H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | LLRNKWXOTKRYAG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|