C12H11Cl2N3O2 — CID 6150186
N-cyclopropyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide (PubChem CID 6150186) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6150186 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c13-8-2-1-7(10(14)5-8)6-15-17-12(19)11(18)16-9-3-4-9/h1-2,5-6,9H,3-4H2,(H,16,18)(H,17,19)/b15-6- |
| InChIKey | FUQCYOAUNUYPKJ-UUASQNMZSA-N |
| XLogP | 1.72 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|