C18H19Cl2N3O2 — CID 999687
(2S)-N-[(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxyanilino)butanamide (PubChem CID 999687) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is (2S)-N-[(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxyanilino)butanamide.
| Compound Name | (2S)-N-[(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxyanilino)butanamide |
|---|---|
| PubChem CID | 999687 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (2S)-N-[(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxyanilino)butanamide |
| SMILES | CC[C@H](Nc1ccccc1OC)C(=O)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-3-15(22-16-6-4-5-7-17(16)25-2)18(24)23-21-11-12-8-9-13(19)10-14(12)20/h4-11,15,22H,3H2,1-2H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | PEUSRFFWQQLFAN-HNNXBMFYSA-N |
| XLogP | 4.34 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|