C20H25N3O3 — CID 135832800
(2R)-2-(2,4-dimethylanilino)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]butanamide (PubChem CID 135832800) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethylanilino)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]butanamide.
| Compound Name | (2R)-2-(2,4-dimethylanilino)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 135832800 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2R)-2-(2,4-dimethylanilino)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]butanamide |
| SMILES | CC[C@@H](Nc1ccc(C)cc1C)C(=O)N/N=C/c1cccc(OC)c1O |
| InChI | InChI=1S/C20H25N3O3/c1-5-16(22-17-10-9-13(2)11-14(17)3)20(25)23-21-12-15-7-6-8-18(26-4)19(15)24/h6-12,16,22,24H,5H2,1-4H3,(H,23,25)/b21-12+/t16-/m1/s1 |
| InChIKey | JTFSCBWSMONXCP-SVZNOHIVSA-N |
| XLogP | 3.36 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|