C20H22ClN3O2 — CID 6041509
(3Z)-N-(3-chloro-4-methylphenyl)-3-(3-phenylpropanoylhydrazinylidene)butanamide (PubChem CID 6041509) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is (3Z)-N-(3-chloro-4-methylphenyl)-3-(3-phenylpropanoylhydrazinylidene)butanamide.
| Compound Name | (3Z)-N-(3-chloro-4-methylphenyl)-3-(3-phenylpropanoylhydrazinylidene)butanamide |
|---|---|
| PubChem CID | 6041509 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3Z)-N-(3-chloro-4-methylphenyl)-3-(3-phenylpropanoylhydrazinylidene)butanamide |
| SMILES | C/C(CC(=O)Nc1ccc(C)c(Cl)c1)=N/NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-14-8-10-17(13-18(14)21)22-20(26)12-15(2)23-24-19(25)11-9-16-6-4-3-5-7-16/h3-8,10,13H,9,11-12H2,1-2H3,(H,22,26)(H,24,25)/b23-15- |
| InChIKey | FNTMSQPFZOVWOT-HAHDFKILSA-N |
| XLogP | 4.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|