C20H19ClN4O5 — CID 6020360
N'-[(Z)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide (PubChem CID 6020360) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is N'-[(Z)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 6020360 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | N'-[(Z)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide |
| SMILES | C/C(CC(=O)Nc1ccc2c(c1)OCO2)=N/NC(=O)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClN4O5/c1-11-3-4-13(8-15(11)21)23-19(27)20(28)25-24-12(2)7-18(26)22-14-5-6-16-17(9-14)30-10-29-16/h3-6,8-9H,7,10H2,1-2H3,(H,22,26)(H,23,27)(H,25,28)/b24-12- |
| InChIKey | OQOCFDIDBHQWHU-MSXFZWOLSA-N |
| XLogP | 2.84 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|