C20H21N3O6 — CID 17384616
(3E)-N-(1,3-benzodioxol-5-yl)-3-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]butanamide (PubChem CID 17384616) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is (3E)-N-(1,3-benzodioxol-5-yl)-3-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]butanamide.
| Compound Name | (3E)-N-(1,3-benzodioxol-5-yl)-3-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 17384616 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (3E)-N-(1,3-benzodioxol-5-yl)-3-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]butanamide |
| SMILES | COc1ccc(OCC(=O)N/N=C(\C)CC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H21N3O6/c1-13(9-19(24)21-14-3-8-17-18(10-14)29-12-28-17)22-23-20(25)11-27-16-6-4-15(26-2)5-7-16/h3-8,10H,9,11-12H2,1-2H3,(H,21,24)(H,23,25)/b22-13+ |
| InChIKey | VBHVYLRLBLRXMO-LPYMAVHISA-N |
| XLogP | 2.32 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|