C19H18ClN3O4 — CID 3105547
2-chloro-N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-oxobutan-2-ylidene]amino]benzamide (PubChem CID 3105547) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-chloro-N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-oxobutan-2-ylidene]amino]benzamide.
| Compound Name | 2-chloro-N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-oxobutan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 3105547 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-chloro-N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-oxobutan-2-ylidene]amino]benzamide |
| SMILES | CC(CC(=O)Nc1ccc2c(c1)OCCO2)=NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN3O4/c1-12(22-23-19(25)14-4-2-3-5-15(14)20)10-18(24)21-13-6-7-16-17(11-13)27-9-8-26-16/h2-7,11H,8-10H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | DLWPBKJOFDJNJW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|