C18H16N4O6 — CID 17384613
N-[(E)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-2-nitrobenzamide (PubChem CID 17384613) has the molecular formula C18H16N4O6 and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[(E)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-2-nitrobenzamide.
| Compound Name | N-[(E)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 17384613 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[(E)-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]-2-nitrobenzamide |
| SMILES | C/C(CC(=O)Nc1ccc2c(c1)OCO2)=N\NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N4O6/c1-11(20-21-18(24)13-4-2-3-5-14(13)22(25)26)8-17(23)19-12-6-7-15-16(9-12)28-10-27-15/h2-7,9H,8,10H2,1H3,(H,19,23)(H,21,24)/b20-11+ |
| InChIKey | FQWLPQXYZJBXBK-RGVLZGJSSA-N |
| XLogP | 2.46 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|