C18H21ClN2OS — CID 9241556
1-[2-(2-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)-1-methylthiourea (PubChem CID 9241556) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is 1-[2-(2-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)-1-methylthiourea.
| Compound Name | 1-[2-(2-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 9241556 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[2-(2-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)-1-methylthiourea |
| SMILES | Cc1ccc(NC(=S)N(C)CCOc2ccccc2Cl)cc1C |
| InChI | InChI=1S/C18H21ClN2OS/c1-13-8-9-15(12-14(13)2)20-18(23)21(3)10-11-22-17-7-5-4-6-16(17)19/h4-9,12H,10-11H2,1-3H3,(H,20,23) |
| InChIKey | YJWMEKSMCLSTGV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|