C16H26N2S — CID 7943536
1-(3,4-dimethylphenyl)-3-[(2R)-5-methylhexan-2-yl]thiourea (PubChem CID 7943536) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[(2R)-5-methylhexan-2-yl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[(2R)-5-methylhexan-2-yl]thiourea |
|---|---|
| PubChem CID | 7943536 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[(2R)-5-methylhexan-2-yl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](C)CCC(C)C)cc1C |
| InChI | InChI=1S/C16H26N2S/c1-11(2)6-8-14(5)17-16(19)18-15-9-7-12(3)13(4)10-15/h7,9-11,14H,6,8H2,1-5H3,(H2,17,18,19)/t14-/m1/s1 |
| InChIKey | PHXQXKPJYRXUOQ-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|