C20H28N2S2 — CID 5160056
3-(3,4-dimethylphenyl)-1-(3-methylbutyl)-1-(1-thiophen-2-ylethyl)thiourea (PubChem CID 5160056) has the molecular formula C20H28N2S2 and a molecular weight of 360.59 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-(3-methylbutyl)-1-(1-thiophen-2-ylethyl)thiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1-(3-methylbutyl)-1-(1-thiophen-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 5160056 |
| Molecular Formula | C20H28N2S2 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-(3-methylbutyl)-1-(1-thiophen-2-ylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCC(C)C)C(C)c2cccs2)cc1C |
| InChI | InChI=1S/C20H28N2S2/c1-14(2)10-11-22(17(5)19-7-6-12-24-19)20(23)21-18-9-8-15(3)16(4)13-18/h6-9,12-14,17H,10-11H2,1-5H3,(H,21,23) |
| InChIKey | KIPBMGRAVAWTLZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|