C22H33N2O3S2+ — CID 4547942
4-tert-butyl-N-(3-morpholin-4-ium-4-ylpropyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 4547942) has the molecular formula C22H33N2O3S2+ and a molecular weight of 437.65 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-morpholin-4-ium-4-ylpropyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(3-morpholin-4-ium-4-ylpropyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4547942 |
| Molecular Formula | C22H33N2O3S2+ |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 4-tert-butyl-N-(3-morpholin-4-ium-4-ylpropyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(CCC[NH+]2CCOCC2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C22H32N2O3S2/c1-22(2,3)19-7-9-21(10-8-19)29(25,26)24(18-20-6-4-17-28-20)12-5-11-23-13-15-27-16-14-23/h4,6-10,17H,5,11-16,18H2,1-3H3/p+1 |
| InChIKey | BXADJPLLDWAWKL-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |