C20H25N3O9S2 — CID 126460321
N-(3-morpholin-4-ylpropyl)-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide;oxalic acid (PubChem CID 126460321) has the molecular formula C20H25N3O9S2 and a molecular weight of 515.57 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide;oxalic acid.
| Compound Name | N-(3-morpholin-4-ylpropyl)-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 126460321 |
| Molecular Formula | C20H25N3O9S2 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=[N+]([O-])c1cccc(S(=O)(=O)N(CCCN2CCOCC2)Cc2cccs2)c1 |
| InChI | InChI=1S/C18H23N3O5S2.C2H2O4/c22-21(23)16-4-1-6-18(14-16)28(24,25)20(15-17-5-2-13-27-17)8-3-7-19-9-11-26-12-10-19;3-1(4)2(5)6/h1-2,4-6,13-14H,3,7-12,15H2;(H,3,4)(H,5,6) |
| InChIKey | LDBOIKVXJPIXMR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|