C19H18Cl3FN2OS — CID 17370471
1-[(2-chloro-6-fluorophenyl)methyl]-3-(2,5-dichlorophenyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 17370471) has the molecular formula C19H18Cl3FN2OS and a molecular weight of 447.79 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2,5-dichlorophenyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2,5-dichlorophenyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17370471 |
| Molecular Formula | C19H18Cl3FN2OS |
| Molecular Weight | 447.79 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2,5-dichlorophenyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Fc1cccc(Cl)c1CN(CC1CCCO1)C(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H18Cl3FN2OS/c20-12-6-7-16(22)18(9-12)24-19(27)25(10-13-3-2-8-26-13)11-14-15(21)4-1-5-17(14)23/h1,4-7,9,13H,2-3,8,10-11H2,(H,24,27) |
| InChIKey | DZYDOPALVCRJMK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.79 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|