C8H8ClNaO4S — CID 165456063
sodium 5-chloro-2,4-dimethoxybenzenesulfinate (PubChem CID 165456063) has the molecular formula C8H8ClNaO4S and a molecular weight of 258.66 g/mol. Its IUPAC name is sodium 5-chloro-2,4-dimethoxybenzenesulfinate.
| Compound Name | sodium 5-chloro-2,4-dimethoxybenzenesulfinate |
|---|---|
| PubChem CID | 165456063 |
| Molecular Formula | C8H8ClNaO4S |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | sodium 5-chloro-2,4-dimethoxybenzenesulfinate |
| SMILES | COc1cc(OC)c(S(=O)[O-])cc1Cl.[Na+] |
| InChI | InChI=1S/C8H9ClO4S.Na/c1-12-6-4-7(13-2)8(14(10)11)3-5(6)9;/h3-4H,1-2H3,(H,10,11);/q;+1/p-1 |
| InChIKey | IZVOSRHZPNOXSN-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|