C9H11NaO3S — CID 131024567
sodium 4-methoxy-2,6-dimethylbenzenesulfinate (PubChem CID 131024567) has the molecular formula C9H11NaO3S and a molecular weight of 222.24 g/mol. Its IUPAC name is sodium 4-methoxy-2,6-dimethylbenzenesulfinate.
| Compound Name | sodium 4-methoxy-2,6-dimethylbenzenesulfinate |
|---|---|
| PubChem CID | 131024567 |
| Molecular Formula | C9H11NaO3S |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | sodium 4-methoxy-2,6-dimethylbenzenesulfinate |
| SMILES | COc1cc(C)c(S(=O)[O-])c(C)c1.[Na+] |
| InChI | InChI=1S/C9H12O3S.Na/c1-6-4-8(12-3)5-7(2)9(6)13(10)11;/h4-5H,1-3H3,(H,10,11);/q;+1/p-1 |
| InChIKey | FJHCTANTUSTSCA-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|