C17H28N2OS — CID 166075123
1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-4-methylpiperazine (PubChem CID 166075123) has the molecular formula C17H28N2OS and a molecular weight of 308.49 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-4-methylpiperazine.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-4-methylpiperazine |
|---|---|
| PubChem CID | 166075123 |
| Molecular Formula | C17H28N2OS |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-4-methylpiperazine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H28N2OS/c1-13-11-15(17(3,4)5)12-14(2)16(13)21(20)19-9-7-18(6)8-10-19/h11-12H,7-10H2,1-6H3 |
| InChIKey | BSHXDCDKLVRNJH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |