C22H31N3 — CID 149041478
1-(1,1-diphenylethyl)-4,7-dimethyl-1,4,7-triazonane (PubChem CID 149041478) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-(1,1-diphenylethyl)-4,7-dimethyl-1,4,7-triazonane.
| Compound Name | 1-(1,1-diphenylethyl)-4,7-dimethyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 149041478 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 1-(1,1-diphenylethyl)-4,7-dimethyl-1,4,7-triazonane |
| SMILES | CN1CCN(C)CCN(C(C)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H31N3/c1-22(20-10-6-4-7-11-20,21-12-8-5-9-13-21)25-18-16-23(2)14-15-24(3)17-19-25/h4-13H,14-19H2,1-3H3 |
| InChIKey | QHQZLFLRQVQSDP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |