C19H18F5N — CID 86244142
1-[1-(2,3,4,5,6-pentafluorophenyl)-1-phenylethyl]piperidine (PubChem CID 86244142) has the molecular formula C19H18F5N and a molecular weight of 355.35 g/mol. Its IUPAC name is 1-[1-(2,3,4,5,6-pentafluorophenyl)-1-phenylethyl]piperidine.
| Compound Name | 1-[1-(2,3,4,5,6-pentafluorophenyl)-1-phenylethyl]piperidine |
|---|---|
| PubChem CID | 86244142 |
| Molecular Formula | C19H18F5N |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[1-(2,3,4,5,6-pentafluorophenyl)-1-phenylethyl]piperidine |
| SMILES | CC(c1ccccc1)(c1c(F)c(F)c(F)c(F)c1F)N1CCCCC1 |
| InChI | InChI=1S/C19H18F5N/c1-19(12-8-4-2-5-9-12,25-10-6-3-7-11-25)13-14(20)16(22)18(24)17(23)15(13)21/h2,4-5,8-9H,3,6-7,10-11H2,1H3 |
| InChIKey | XFYVLDJAYRPTNX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|