C16H25IN2 — CID 67653875
1-iodo-2-methyl-1-phenyl-2-piperidin-1-ylbutan-1-amine (PubChem CID 67653875) has the molecular formula C16H25IN2 and a molecular weight of 372.29 g/mol. Its IUPAC name is 1-iodo-2-methyl-1-phenyl-2-piperidin-1-ylbutan-1-amine.
| Compound Name | 1-iodo-2-methyl-1-phenyl-2-piperidin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 67653875 |
| Molecular Formula | C16H25IN2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-iodo-2-methyl-1-phenyl-2-piperidin-1-ylbutan-1-amine |
| SMILES | CCC(C)(N1CCCCC1)C(N)(I)c1ccccc1 |
| InChI | InChI=1S/C16H25IN2/c1-3-15(2,19-12-8-5-9-13-19)16(17,18)14-10-6-4-7-11-14/h4,6-7,10-11H,3,5,8-9,12-13,18H2,1-2H3 |
| InChIKey | XYKHGPAMVDNQGM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|