C19H28N2S2 — CID 15339011
methyl 2-phenyl-2,2-di(piperidin-1-yl)ethanedithioate (PubChem CID 15339011) has the molecular formula C19H28N2S2 and a molecular weight of 348.58 g/mol. Its IUPAC name is methyl 2-phenyl-2,2-di(piperidin-1-yl)ethanedithioate.
| Compound Name | methyl 2-phenyl-2,2-di(piperidin-1-yl)ethanedithioate |
|---|---|
| PubChem CID | 15339011 |
| Molecular Formula | C19H28N2S2 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 2-phenyl-2,2-di(piperidin-1-yl)ethanedithioate |
| SMILES | CSC(=S)C(c1ccccc1)(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C19H28N2S2/c1-23-18(22)19(17-11-5-2-6-12-17,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2,5-6,11-12H,3-4,7-10,13-16H2,1H3 |
| InChIKey | YCTGOZTVVSTLEE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|