C20H26O2 — CID 157373882
4-tert-butyl-2,6-dimethylphenol;octa-2,4,6-triyne;hydrate (PubChem CID 157373882) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethylphenol;octa-2,4,6-triyne;hydrate.
| Compound Name | 4-tert-butyl-2,6-dimethylphenol;octa-2,4,6-triyne;hydrate |
|---|---|
| PubChem CID | 157373882 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-tert-butyl-2,6-dimethylphenol;octa-2,4,6-triyne;hydrate |
| SMILES | CC#CC#CC#CC.Cc1cc(C(C)(C)C)cc(C)c1O.O |
| InChI | InChI=1S/C12H18O.C8H6.H2O/c1-8-6-10(12(3,4)5)7-9(2)11(8)13;1-3-5-7-8-6-4-2;/h6-7,13H,1-5H3;1-2H3;1H2 |
| InChIKey | ALPJEQSRJIMZOF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|