C18H20F2 — CID 160880987
4-tert-butyl-2-fluoro-1-methylbenzene;hepta-1,3,5-triyne;hydrofluoride (PubChem CID 160880987) has the molecular formula C18H20F2 and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-tert-butyl-2-fluoro-1-methylbenzene;hepta-1,3,5-triyne;hydrofluoride.
| Compound Name | 4-tert-butyl-2-fluoro-1-methylbenzene;hepta-1,3,5-triyne;hydrofluoride |
|---|---|
| PubChem CID | 160880987 |
| Molecular Formula | C18H20F2 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-tert-butyl-2-fluoro-1-methylbenzene;hepta-1,3,5-triyne;hydrofluoride |
| SMILES | C#CC#CC#CC.Cc1ccc(C(C)(C)C)cc1F.F |
| InChI | InChI=1S/C11H15F.C7H4.FH/c1-8-5-6-9(7-10(8)12)11(2,3)4;1-3-5-7-6-4-2;/h5-7H,1-4H3;1H,2H3;1H |
| InChIKey | SNAGNULXHJGUMR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|