C24H36OS2 — CID 145389274
4-[(4-tert-butyl-3,5-dimethylphenyl)disulfanyl]-2,6-dimethylphenol;2-methylpropane (PubChem CID 145389274) has the molecular formula C24H36OS2 and a molecular weight of 404.69 g/mol. Its IUPAC name is 4-[(4-tert-butyl-3,5-dimethylphenyl)disulfanyl]-2,6-dimethylphenol;2-methylpropane.
| Compound Name | 4-[(4-tert-butyl-3,5-dimethylphenyl)disulfanyl]-2,6-dimethylphenol;2-methylpropane |
|---|---|
| PubChem CID | 145389274 |
| Molecular Formula | C24H36OS2 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 4-[(4-tert-butyl-3,5-dimethylphenyl)disulfanyl]-2,6-dimethylphenol;2-methylpropane |
| SMILES | CC(C)C.Cc1cc(SSc2cc(C)c(C(C)(C)C)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C20H26OS2.C4H10/c1-12-8-16(9-13(2)18(12)20(5,6)7)22-23-17-10-14(3)19(21)15(4)11-17;1-4(2)3/h8-11,21H,1-7H3;4H,1-3H3 |
| InChIKey | GIZCGGTWGXJSMU-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|