C12H10ClF3O3 — CID 117475184
2-[1-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]cyclopropyl]acetic acid (PubChem CID 117475184) has the molecular formula C12H10ClF3O3 and a molecular weight of 294.66 g/mol. Its IUPAC name is 2-[1-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117475184 |
| Molecular Formula | C12H10ClF3O3 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[1-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(c2cc(C(F)(F)F)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C12H10ClF3O3/c13-8-4-6(12(14,15)16)3-7(10(8)19)11(1-2-11)5-9(17)18/h3-4,19H,1-2,5H2,(H,17,18) |
| InChIKey | LHCGDLNDRORROM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |