C13H18Cl2 — CID 115485114
1-chloro-2-(4-chloro-2-methylbutan-2-yl)-4,5-dimethylbenzene (PubChem CID 115485114) has the molecular formula C13H18Cl2 and a molecular weight of 245.19 g/mol. Its IUPAC name is 1-chloro-2-(4-chloro-2-methylbutan-2-yl)-4,5-dimethylbenzene.
| Compound Name | 1-chloro-2-(4-chloro-2-methylbutan-2-yl)-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 115485114 |
| Molecular Formula | C13H18Cl2 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-chloro-2-(4-chloro-2-methylbutan-2-yl)-4,5-dimethylbenzene |
| SMILES | Cc1cc(Cl)c(C(C)(C)CCCl)cc1C |
| InChI | InChI=1S/C13H18Cl2/c1-9-7-11(12(15)8-10(9)2)13(3,4)5-6-14/h7-8H,5-6H2,1-4H3 |
| InChIKey | DPJGQCZDMPVDTH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|