About 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid
4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid (PubChem CID 81045453) has the molecular formula C11H10ClF3O2
and a molecular weight of 266.65 g/mol. Its IUPAC name is 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid.
Analyze 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid?
The IUPAC name of 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid (CID 81045453) is 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid.
What is the SMILES notation for 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid?
The canonical SMILES for 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid is Cc1cc(C(F)(F)CCC(=O)O)c(Cl)cc1F.
What is the InChIKey of 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid?
The InChIKey is XTRDMCQTIAYFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF3O2/c1-6-4-7(8(12)5-9(6)13)11(14,15)3-2-10(16)17/h4-5H,2-3H2,1H3,(H,16,17).
What are the key properties of 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid?
4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid has a molecular weight of 266.65 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-4-fluoro-5-methylphenyl)-4,4-difluorobutanoic acid is sourced from PubChem (CID 81045453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).